On Target FABP5_HUMAN 0.2948718/CHEMBL4292072
For the given ligand pH, we have found in our database that, being scored 0.2948718, the most similar ligand is CHEMBL4292072. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL4292072 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | O=C(O)C1C(c2ccccc2)C(C(=O)Oc2cccc3ccccc23)C1c1ccccc1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 04010000 01000008 2000010a 00010300 00081000 02000000 02000000 00000000 00000800 000a0840 08100000 40009000 0480802a 02a00010 11010001 000a2008 00820000 02000000 00402008 00020001 00000100 08000a08 11000040 00400010 00000800 80000000 00000000 00000000 00000202 00020002 00000000 10000400 |