On Target PAR1_HUMAN 0.25/CHEMBL387441
For the given ligand pH, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL387441. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL387441 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | COc1ccc2nc(/C=C/[C@@H]3[C@H]([C@@H](C)O)[C@H](CO)C[C@@H]4CCCC[C@H]43)ccc2c1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00000002 81000008 20004308 10010600 002c1020 00000000 82080080 08000408 00000000 00100848 00000004 40008000 00020806 00c00000 01020443 020c000c 00000400 0a000000 02602000 00022001 40000000 08008008 21808020 80410010 01002000 82000000 00406040 c0008200 00400204 00060000 24060000 00000000 |