On Target MK01_HUMAN 0.44927537/CHEMBL319244
For the given ligand pH, we have found in our database that, being scored 0.44927537, the most similar ligand is CHEMBL319244. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL319244 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | O=C(/C=C/c1ccc(O)c(O)c1)OCCc1ccccc1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00040000 40000008 20000100 00010200 00000040 00000000 82000080 00000440 01800000 00080840 48000000 40108000 04008002 00000000 00040002 00088008 08020400 02000000 24018018 00020200 00010020 08000a00 01000001 00400010 00001400 80000000 00422000 40000400 00400200 00020102 04000000 00000410 |