On Target HYES_HUMAN 0.4/CHEMBL32969
For the given ligand pH, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL32969. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL32969 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | COC(=O)/C=C/c1ccc(O)c(OC)c1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00000000 40000008 20000108 00010200 00001000 00000000 82000080 00000400 01800000 00000840 40000000 40108000 0400c002 00000000 01000003 00088008 00020400 02000000 00098018 00020200 00000000 08000a00 00000001 00400000 00001000 80000000 00422000 40000400 00400200 00020100 04000000 00000110 |