On Target TRPV3_HUMAN 0.20325203/CHEMBL3692333
For the given ligand pH, we have found in our database that, being scored 0.20325203, the most similar ligand is CHEMBL3692333. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL3692333 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | C=C(c1ccccc1)c1ccc(F)c(CN[C@@H](CO)C(C)C)n1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 0000009a 00000000 00104100 16010e00 000400a1 00180022 80000080 0b003409 00000000 08080840 08218004 40808000 00000802 00001000 000a0400 020c818d 12048200 020020a3 00600008 00100241 40000000 18018000 23800000 20440010 00100000 e0000000 00002040 c0001201 00400184 00060002 24040800 20004600 |