On Target ADRB2_HUMAN 0.44642857/CHEMBL679
For the given ligand pH, we have found in our database that, being scored 0.44642857, the most similar ligand is CHEMBL679. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL679 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | CNC[C@H](O)c1ccc(O)c(O)c1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00000000 4a000008 20100100 00010600 00000080 80004000 02000000 00000000 00000100 00080840 08200000 40008000 00000002 00000000 00000000 00088008 00000000 02000000 00000000 00020200 00000000 18200020 02000000 81400010 00000000 80000000 00520000 00000000 04000000 00060002 40000000 00000600 |