On Target PPARG_HUMAN 0.45714286/CHEMBL2204694
For the given ligand pH, we have found in our database that, being scored 0.45714286, the most similar ligand is CHEMBL2204694. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL2204694 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | CC(C)(Oc1ccc(CCCOc2ccc(/C=C/c3ccccc3)cc2)cc1)C(=O)O |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 04000000 00000008 20000108 00010300 00001000 02000000 82040080 00000400 00000800 00080840 08140100 4000d000 00808002 00000000 11200003 00082008 00000400 82000000 00400000 00020001 00000100 18000a00 05000041 08400010 00000000 80000000 00522008 40800000 00400200 00020002 04000000 00000400 |