On Target CASP1_HUMAN 0.27659574/CHEMBL37630
For the given ligand pH, we have found in our database that, being scored 0.27659574, the most similar ligand is CHEMBL37630. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL37630 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@H](C=O)CC(=O)O)C(C)C |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00040000 00003208 20100100 04010600 00000000 00000000 02000000 2000000c 00000880 000808c0 08300000 4000b000 0e008002 00002001 80000000 000c0008 00000000 02000001 00c00018 00020201 00000100 38300e00 01000083 83400018 00001801 80000000 00120000 10000000 0c000002 0006000b 20004000 00002600 |