On Target CHLE_HUMAN 0.37349397/CHEMBL2380323
For the given ligand pH, we have found in our database that, being scored 0.37349397, the most similar ligand is CHEMBL2380323. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL2380323 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | CCN(CC)Cc1cccc(C(=O)/C=C/c2ccc(OC)cc2)c1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00000000 00000808 20000308 00010600 00001001 00800000 92040081 02001400 01800000 00b80c40 08200000 40008000 00008822 00000000 01000403 08080008 00000400 02100000 00018400 00020800 00000000 08028200 00008001 00400014 01000000 c0000000 08422000 c0000000 00400300 00060002 84040000 00000600 |