On Target HPGDS_HUMAN 0.21978022/CHEMBL4476387
For the given ligand pH, we have found in our database that, being scored 0.21978022, the most similar ligand is CHEMBL4476387. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL4476387 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | COc1ccc2cc(C(=O)NC(C)C)cnc2c1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 10000002 00808808 20004108 00010610 00041000 00000000 06004000 02001008 00000000 00000840 01200004 40008000 00008802 00400000 01000441 0004000c 00020000 02000004 00200000 00060000 c0000000 08068e08 20800000 8040001c 00040000 c0000000 08000000 80000000 00400300 00060001 80040000 80200200 |