On Target NOS1_HUMAN 0.3275862/CHEMBL107201
For the given ligand pH, we have found in our database that, being scored 0.3275862, the most similar ligand is CHEMBL107201. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL107201 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | N=C(N)SCCc1cccc(CCSC(=N)N)c1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00000000 00000000 00000140 00110200 00000001 00000800 00000000 00000000 00000000 01094842 88000000 40008000 00010000 000c0000 00000000 00080008 04000000 02000000 00000020 00000000 00000000 08000000 00000101 02400010 00000000 90000000 40000000 04800000 00000000 00070012 00000000 01010400 |