On Target ALDR_HUMAN 0.50793654/CHEMBL129795
For the given ligand pH, we have found in our database that, being scored 0.50793654, the most similar ligand is CHEMBL129795. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL129795 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | O=C(/C=C/c1ccc(O)cc1)c1ccc(O)cc1O |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00000001 00000808 20000301 00010202 00000000 00820000 82000081 00000600 01840000 00b80840 08000000 40008000 00008002 00000000 00000002 00002008 00000400 02100000 00018000 00020800 00000000 08020200 00008001 00400014 01000000 80000000 00522000 40000000 00400000 00020002 84000000 00000400 |