On Target TRPM4_HUMAN 0.17117117/CHEMBL1408302
For the given ligand pH, we have found in our database that, being scored 0.17117117, the most similar ligand is CHEMBL1408302. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL1408302 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | O=C(COc1cccc2ccccc12)Nc1cc(Cl)ccc1C(=O)O |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 1401e002 00000808 20001108 01010602 00001080 00014040 0a000000 00080100 00800100 00080840 002c0084 4000d800 06808086 00100001 01021041 00080008 00040000 82000000 08000000 00024000 40100000 08060f28 32002000 00400004 00002000 80000000 08040018 00001080 00008200 00060001 c0000000 00020200 |