On Target PGH1_SHEEP 0.59090906/CHEMBL165
For the given ligand pH, we have found in our database that, being scored 0.59090906, the most similar ligand is CHEMBL165. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL165 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | Oc1ccc(/C=C/c2cc(O)cc(O)c2)cc1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00000001 40000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00000840 00000100 40108000 00000002 00000000 00000002 00000008 00000400 02000000 00000000 00020a00 00000000 18000000 00000001 00400000 00000000 80000000 00422000 40000000 00400000 00020100 04000000 00000000 |