On Target P2RX3_HUMAN 0.26373628/CHEMBL3958199
For the given ligand pH, we have found in our database that, being scored 0.26373628, the most similar ligand is CHEMBL3958199. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL3958199 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | CCNc1ccc(Nc2ccc(OC(C)C)cc2)c(Cc2ccc(Cl)cc2)c1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 0c00c002 00001008 60000108 00010600 00001020 00080000 02000010 01000048 00402000 00080850 08200004 40008800 02800026 00000000 01020041 00080008 00048000 02000001 08000002 00020000 44100000 08040100 20000000 00400010 00042000 a0000000 02040008 40001080 00408280 00260002 00000000 20020600 |