On Target NOS2_HUMAN 0.33962265/CHEMBL448703
For the given ligand pH, we have found in our database that, being scored 0.33962265, the most similar ligand is CHEMBL448703. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL448703 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | Br.CC(=N)N[C@@H](C)c1ccccc1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00000000 00000000 00000100 00010600 00000000 00000000 00000000 02001000 00000000 00080853 08200000 40008000 00000802 00000000 00000400 00100000 00000000 02000000 00000000 00000000 00000000 08008000 00000000 00400010 00000000 c0000000 40000000 90000000 00000110 00060002 00040008 00000600 |