On Target SCN9A_HUMAN 0.3/CHEMBL381488
For the given ligand pH, we have found in our database that, being scored 0.3, the most similar ligand is CHEMBL381488. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL381488 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | OC(CCc1ccccc1)[C@@H]1CCC[C@H]1COCc1ccc(OC(F)(F)F)cc1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00000000 01000008 2010010a 00010300 00281010 00004000 02040000 00000000 00000900 00080840 08100000 40408000 00000002 00a10000 01000001 02081008 00800000 02000000 10402000 00020001 00000120 08000020 01000048 00400010 00000400 80002000 004a0000 c0000000 02000202 01020002 40020000 02000600 |