On Target PRGR_HUMAN 0.36764705/CHEMBL511812
For the given ligand pH, we have found in our database that, being scored 0.36764705, the most similar ligand is CHEMBL511812. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL511812 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | CC[C@@]12C[C@H](O)[C@](O)(c3ccccc3)C[C@H]1CCc1cc(O)ccc12 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00000000 43000008 20000102 00010200 00080040 40004002 02001000 00000001 00000900 00080840 08100000 40008000 00000002 00a00000 00040020 00080008 08000200 02000000 02402000 00020201 00000100 08000020 05004040 00400010 00000000 80000001 00120000 00000000 00000002 00020002 40020000 00000400 |