On Target AA2AR_HUMAN 0.3968254/CHEMBL496
For the given ligand pH, we have found in our database that, being scored 0.3968254, the most similar ligand is CHEMBL496. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL496 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | Oc1c(Cl)cc(Cl)c(Cl)c1Cc1c(O)c(Cl)cc(Cl)c1Cl |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00008000 04000008 20000100 00010200 00000000 00000020 16000000 01000200 00000000 80480844 08000000 40008800 02000006 00000402 80000000 00002008 00000000 02000000 00000000 00020000 00000400 08000100 00000020 00400010 00002000 a0100a00 20100000 40000080 00000080 00020002 06000000 00020400 |