On Target CXCR1_HUMAN 0.2888889/CHEMBL4442431
For the given ligand pH, we have found in our database that, being scored 0.2888889, the most similar ligand is CHEMBL4442431. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL4442431 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | C[C@@H](C(=O)[N-]S(C)(=O)=O)c1ccc(OS(=O)(=O)C(F)(F)F)cc1.[Na+] |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00000040 20020008 20100300 01710600 20002020 00000000 82010000 00001200 00800000 00c80840 08002000 40009000 01008003 00200003 c0080000 00001008 02000000 02000000 00810000 00024000 00000000 19000600 00000000 91400011 02080000 80000000 10120000 8000000c 04000000 00060402 00002000 00010e60 |