On Target PGH2_HUMAN 0.6530612/CHEMBL491079
For the given ligand pH, we have found in our database that, being scored 0.6530612, the most similar ligand is CHEMBL491079. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL491079 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | C/C(=C\c1ccc(C(F)(F)F)cc1)c1ccc(O)cc1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00000000 00000008 20100100 00010200 00000000 00000000 82000480 00000400 00000100 00080850 08000100 40008000 00000002 01000000 00000002 00000008 00000400 02000000 00000000 00020000 01000000 18000000 00000001 00400010 00000000 80000000 00522100 d0000000 00400000 00020002 04100000 00000600 |