On Target CNR2_HUMAN 0.48214287/CHEMBL16901
For the given ligand pH, we have found in our database that, being scored 0.48214287, the most similar ligand is CHEMBL16901. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL16901 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | C=CCc1ccc(O)c(-c2ccc(O)c(CC=C)c2)c1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00002000 00000008 20000100 00010200 00000001 00800000 02000001 00000600 00040000 00180840 08000000 40008000 00400032 00000000 00000000 00082008 00020000 02101000 04000000 00020000 00000000 08000000 10000000 00404010 00000000 80000080 10120000 00000041 00004000 00020002 04000200 00000400 |