On Target MTOR_HUMAN 0.29545453/CHEMBL4214825
For the given ligand pH, we have found in our database that, being scored 0.29545453, the most similar ligand is CHEMBL4214825. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL4214825 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | COc1cc(O)c(C(=O)C#Cc2cc(OC)c(OC)c(OC)c2)c(OC)c1 |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00000201 40020808 20000909 02091200 00403010 40020000 42040000 00000200 00000000 00080840 08800000 40008008 0008c002 00001001 01000001 0000a008 00000000 02000404 00080000 00021a00 00000000 08820200 00000001 02400017 00000044 c0000002 00120800 00000000 00000300 0002400a 80000800 00100400 |