On Target PTGES_HUMAN 0.375/CHEMBL140
For the given ligand pH, we have found in our database that, being scored 0.375, the most similar ligand is CHEMBL140. Check out the elaboration below.
| pH (Given Ligand) | CHEMBL140 (Similar Ligand) |
|---|---|
| C=C(C)c1ccc(O)cc1 | COc1cc(/C=C/C(=O)CC(=O)/C=C/c2ccc(O)c(OC)c2)ccc1O |
|
|
|
|
|
|
| 00000000 00000008 20000100 00010200 00000000 00000000 82000080 00000400 00000000 00080840 08000000 40008000 00000002 00000000 00000000 00000008 00000000 02000000 00000000 00020000 00000000 08000000 00000001 00400010 00000000 80000000 00122000 00000000 00400000 00020002 04000000 00000400 | 00000000 41000008 20000308 00010200 00001000 00000000 82000080 00000400 01800100 00100840 00000000 40109000 0402c002 00000000 01000403 00008008 00000400 02000000 00098000 02020201 00000000 08000200 00008021 00400010 01000000 80000000 00426200 c0000000 00400200 80020100 04000000 00000100 |