On Target PDE5A_HUMAN 0.278481/CHEMBL422006
For the given ligand OI5, we have found in our database that, being scored 0.278481, the most similar ligand is CHEMBL422006. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL422006 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | Oc1c2c(nc3ccccc13)C(c1ccc3c(c1)OCO3)N(C/C=C/c1ccccc1)C2 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 1000000a 46008008 20004108 10010e10 00041020 00180000 82144480 03003401 00200000 00580840 49218004 40808000 00004882 20610000 01020443 0224a18c 20022400 02000107 10280000 00860200 40060200 08008808 20804000 80468010 40140000 e0200000 087a6240 e0010000 03400384 00060002 04040000 a0254600 |