On Target COMT_HUMAN 0.34745762/CHEMBL4639358
For the given ligand OI5, we have found in our database that, being scored 0.34745762, the most similar ligand is CHEMBL4639358. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL4639358 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | COc1cccc(/C=C/C(=O)c2cc(O)c(O)c([N+](=O)[O-])c2)c1 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00000002 c2000c18 20001309 00010200 00001000 00800000 82002081 00000400 15c00000 00b80860 0c800004 40108000 00018202 00000000 21100143 3000c018 00000400 02100000 00098000 00020e00 40020000 08020200 20008000 00401414 01040000 c0000000 00522000 4000a000 80400200 00060102 84000000 24000500 |