On Target PAR1_HUMAN 0.2977099/CHEMBL80942
For the given ligand OI5, we have found in our database that, being scored 0.2977099, the most similar ligand is CHEMBL80942. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL80942 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | O=C(O)C[C@H](NC(=O)[C@@H]1CCCN(C(=O)CCC2CCNCC2)C1)c1ccc2c(c1)OCO2 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00010000 47801408 20100108 00010600 00001000 40000000 02040000 22001000 00200800 000809e0 48300000 50019000 0c00c81a 20000000 01000401 00288008 00000000 02000001 00c82018 00020201 80040300 181c8e30 010000c0 00548018 40001801 c0000000 00320000 b0000000 01000300 00060013 20040000 00012600 |