On Target ADRB2_HUMAN 0.44329897/CHEMBL513389
For the given ligand OI5, we have found in our database that, being scored 0.44329897, the most similar ligand is CHEMBL513389. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL513389 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | Cc1ccc(OCC(O)C(C)NC(C)C)c2c1CCC2 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 04000000 43000008 2010010a 00010700 00001081 c2000000 02040000 00000200 00000810 00080840 08300000 40008040 00800002 20201080 11200021 000a2008 10200000 22008000 00c80000 00020201 00000100 18000000 07004080 08400410 00000001 c0000001 00020000 00800000 00000300 00064002 00000000 00000640 |