On Target PPAP_HUMAN 0.29126215/CHEMBL507996
For the given ligand OI5, we have found in our database that, being scored 0.29126215, the most similar ligand is CHEMBL507996. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL507996 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | COc1ccc([C@@H](N[C@H](C)c2ccccc2)P(=O)(O)O)cc1.Cl |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00010010 00000608 20000108 00010600 00001000 00400000 06040000 82001000 000000c0 00080840 08200000 40008000 00000802 00020000 8108040d 00000008 00003028 02000000 00000000 00020200 00000000 0d308000 00000000 00400010 00000000 c6010006 00220000 80014000 00000300 30060002 00040000 00028603 |