On Target ACM4_HUMAN 0.4698795/CHEMBL83
For the given ligand OI5, we have found in our database that, being scored 0.4698795, the most similar ligand is CHEMBL83. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL83 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | CC/C(=C(\c1ccccc1)c1ccc(OCCN(C)C)cc1)c1ccccc1 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 04002000 00000008 20000308 00010602 00001080 00000000 82040080 01000400 00000800 00180840 08300100 40008000 00800002 00000000 01001003 00080008 00000400 02000000 00000000 00020001 00000100 18040000 12008001 00400010 01000000 a0000000 00522000 40000000 00400280 00060002 04000000 00000600 |