On Target TNFA_HUMAN 0.375/CHEMBL63
For the given ligand OI5, we have found in our database that, being scored 0.375, the most similar ligand is CHEMBL63. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL63 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | COc1ccc(C2CNC(=O)C2)cc1OC1CCCC1 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 04020000 43001208 20100108 00210700 00081000 c2000010 02040000 00000004 00000880 000808c0 08300000 40009000 0480c002 20000080 11000001 020ca008 00800000 02000000 00480008 00020201 00000100 18200600 01000000 81400018 00000800 80000000 00120000 10000000 04000200 0106000b 00000000 00000640 |