On Target NOS1_HUMAN 0.36607143/CHEMBL85613
For the given ligand OI5, we have found in our database that, being scored 0.36607143, the most similar ligand is CHEMBL85613. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL85613 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | COc1ccc2c(c1)[C@H]1CCC[C@H]1C(N)=N2 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00000002 43200208 2000010a 00010e20 00001000 40200000 13000010 00002008 00000800 000a08c3 08110004 40018000 10001002 60200008 010200c1 00000008 00000800 02000000 01082008 10020201 40000101 18010110 20000000 00400810 00090000 88100001 40040400 00000800 00080202 0186000a 000a0000 20100500 |