On Target OPRK_HUMAN 0.525641/CHEMBL4472703
For the given ligand OI5, we have found in our database that, being scored 0.525641, the most similar ligand is CHEMBL4472703. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL4472703 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | CC[C@H]1c2cc(OC)ccc2CC[C@@]1(C)N |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00000000 43000208 2000010a 00010600 00001020 c0000002 02040000 00000001 00000800 000808c0 08100000 40808000 00000002 20200000 01000021 02000008 00000200 02000000 00082000 00020201 00000100 18000000 00004000 81400010 00000000 80000001 00120000 00000000 04000202 0006000a 00020000 00000400 |