On Target AOFB_HUMAN 0.516129/CHEMBL3918471
For the given ligand OI5, we have found in our database that, being scored 0.516129, the most similar ligand is CHEMBL3918471. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL3918471 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | COc1cccc(/C=C2\Cc3cc(O)ccc3C2=O)c1 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00000000 43000c08 2000030b 00010200 00001000 40808000 82000081 00000400 81800800 00b80840 08100000 40109000 04008002 00201000 01000003 00020008 00000404 02100000 00098008 00020a01 00000100 08020240 0000c000 00400014 01000800 80000000 00522000 40000000 00400200 00020102 84000000 00000500 |