On Target ACM1_HUMAN 0.5846154/CHEMBL4081662
For the given ligand OI5, we have found in our database that, being scored 0.5846154, the most similar ligand is CHEMBL4081662. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL4081662 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | COc1cccc(CCC[N+](C)(C)C)c1.[I-] |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00000000 42000208 20100108 00010600 00001000 40000000 02000000 00000000 00000800 000808c0 08300000 40008000 00000002 20000000 01000001 00040008 00000000 02000000 00080000 00020201 00000100 18000000 00000000 00400010 00000000 80000000 00000000 10000000 00000200 0006000a 00200000 00000600 |