On Target MDR1_HUMAN 0.53333336/CHEMBL3632925
For the given ligand OI5, we have found in our database that, being scored 0.53333336, the most similar ligand is CHEMBL3632925. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL3632925 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | CC/C(=C(/CC)c1ccc(OCCCO)cc1)c1ccc(OCCCO)cc1 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 04000000 00000008 20000308 00010200 00001000 02000000 82040080 00000402 00000800 01180840 08100100 40008000 00800002 00000000 01000003 00082008 00000400 02000000 01000000 00020001 00000100 18000000 01008001 02400010 01000000 80000000 00522000 40000000 00400200 00020002 04000000 00000400 |