On Target SCN9A_HUMAN 0.3773585/CHEMBL203440
For the given ligand OI5, we have found in our database that, being scored 0.3773585, the most similar ligand is CHEMBL203440. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL203440 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | O=C(NCc1ccccc1)[C@@H]1CCC[C@H]1C(O)CCc1cccc(OC(F)(F)F)c1 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00050000 43800008 2010010a 00010600 00191010 40000000 02000000 22001000 00000800 000808c0 08300000 40419000 0400880a 20a00000 01000401 00080008 00000000 02000000 00482000 00020201 80000100 18008610 01000048 00500018 00000000 c0000000 00000000 d0000000 02000302 01060003 20060000 00000e00 |