On Target AA2AR_HUMAN 0.3956044/CHEMBL2042091
For the given ligand OI5, we have found in our database that, being scored 0.3956044, the most similar ligand is CHEMBL2042091. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL2042091 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | COC(=O)/C(C#N)=C/c1cccc(OC)c1O |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00000000 40000008 20000108 00010220 00201000 00080000 82000080 00000400 01808000 00000840 40000000 40129000 0c00c002 00000000 01000003 0008a008 00420400 02000000 10098018 00020200 00000000 08000a00 01000400 00400010 00001000 80000000 00402100 40000400 00480200 00020100 04000000 00000192 |