On Target CXCR1_HUMAN 0.26553673/CHEMBL220182
For the given ligand OI5, we have found in our database that, being scored 0.26553673, the most similar ligand is CHEMBL220182. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL220182 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | CC[C@@H](Nc1c(Nc2cccc(C(=O)N(C)C)c2O)c(=O)c1=O)c1ccc2c(c1)OCO2 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 1040c002 46000808 6010010a 00012600 20011001 68022000 020400a0 22401500 05a00c40 001808d0 48380004 5042b000 0a00c802 20200000 81020441 1020e048 00050001 22008000 082b0210 20020201 48140b80 18128600 20000000 00448014 44041000 c0000080 20720010 b00c0580 21508302 20060003 a4045420 40012600 |