On Target TRY1_HUMAN 0.3888889/CHEMBL320817
For the given ligand OI5, we have found in our database that, being scored 0.3888889, the most similar ligand is CHEMBL320817. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL320817 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | COc1ccc2ccc(C(=N)N)cc2c1C1CCOC1 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00000000 00000008 20010108 00010700 00001040 00000000 02000000 00009240 00000900 00080843 08100000 40008940 80000802 00000000 010c0001 00082008 08000000 02000000 04400000 00020201 00010120 08008008 01000040 00400410 00000400 c0000000 40000000 00000000 00000308 00070002 40040000 00000400 |