On Target ACE_HUMAN 0.32231405/CHEMBL254495
For the given ligand OI5, we have found in our database that, being scored 0.32231405, the most similar ligand is CHEMBL254495. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL254495 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | CC[C@@H](C)[C@H](S)C(=O)N[C@@H](Cc1cccc(OCc2ccccc2)c1)C(=O)O |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 04010000 43005008 20100108 00110600 00001080 c0004000 82000000 20000004 00000980 020a08c0 08300000 4001b000 06808002 20050080 81080001 02080008 10000000 02000000 00480008 00020201 00000100 18200e20 03000140 85d01018 00000800 80002000 00000000 10000040 04000200 00060003 60004000 03012600 |