On Target 5HT1B_HUMAN 0.49295774/CHEMBL146942
For the given ligand OI5, we have found in our database that, being scored 0.49295774, the most similar ligand is CHEMBL146942. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL146942 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | NCCCC1(CCCN)CCc2cccc(O)c2C1 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00000000 43000008 20000102 00010600 00000000 40000002 02000000 00000201 00000800 000808c0 08100000 40018040 00000002 00200000 00000020 00002008 00000200 02000000 00002000 00020201 00000100 18000010 00004000 00400010 00000000 80000001 00000000 00000000 00000002 00064002 00020000 00000400 |