On Target CXCR4_HUMAN 0.44444445/CHEMBL126657
For the given ligand OI5, we have found in our database that, being scored 0.44444445, the most similar ligand is CHEMBL126657. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL126657 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | COc1cc(/C=C/C(=O)c2ccc(Cl)cc2)ccc1O |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00008000 40000808 20000308 00010200 00001000 00800000 82000081 00000400 01800000 00b80840 08000000 40108800 0200c026 00000000 01000003 00008008 00000400 02100000 00098000 00020a00 00000000 08020300 00008001 00400014 01002000 80000000 00462000 40000000 00400200 00020102 84000000 00020500 |