On Target NTRK1_HUMAN 0.28671327/CHEMBL175321
For the given ligand OI5, we have found in our database that, being scored 0.28671327, the most similar ligand is CHEMBL175321. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL175321 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | O=C1Nc2ccccc2/C1=C1\CCc2cc(O)ccc21 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 10084212 43008008 20100302 00110600 20000000 44000000 82000080 00020400 01800800 20580842 08380104 60009008 01028102 00311000 c0020142 0002010a 24040400 02000100 08018000 00820201 40100100 18200680 2002e021 81400011 01000000 82000200 00522010 c0019280 04408000 00060003 04002000 20010600 |