On Target MTOR_HUMAN 0.34210527/CHEMBL4202641
For the given ligand OI5, we have found in our database that, being scored 0.34210527, the most similar ligand is CHEMBL4202641. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL4202641 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | CCCCCc1c(OC)cc(OC)c(C(=O)C#Cc2cc(OC)c(OC)c(OC)c2)c1O |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00000201 41020808 2000090b 02091200 00403011 40020000 42040000 00000200 00000800 00080a40 08900000 40008048 000ac002 00201001 01000001 0808a008 00000000 02000404 00082000 00021a01 00000100 08820200 01000001 02400417 00000044 c0000002 00120800 00800000 00000302 0002400a 80000800 00100400 |