On Target FYN_HUMAN 0.3655914/CHEMBL221753
For the given ligand OI5, we have found in our database that, being scored 0.3655914, the most similar ligand is CHEMBL221753. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL221753 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | CC(C)(C)CC(C)(C)c1ccc(OCCOCC[N+](C)(C)Cc2ccccc2)cc1.[Cl-] |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 04000008 01000008 2000010a 80010600 00001080 00000000 02040000 02001040 00002800 00080840 08300000 40008000 00800802 00200000 01201409 00090008 10000000 02000000 00000002 00020001 00000100 08008000 16000000 08400010 00000400 c0000000 00120000 80800021 00000300 00060002 00040000 00020600 |