On Target TRXR1_HUMAN 0.19565217/CHEMBL4459518
For the given ligand OI5, we have found in our database that, being scored 0.19565217, the most similar ligand is CHEMBL4459518. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL4459518 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | CN(CCOC(=O)/C=C/C(=O)c1ccc(F)cc1)C(C(=O)NC(C)(C)C)c1ccc(F)cc1 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00000008 00000800 00100300 86010600 00000080 00800810 02000001 02001400 01000080 00980840 48200000 4000b000 03008802 00003002 40301408 00080008 10060000 02100180 20210010 00100a00 00000100 38228e80 12008000 8340001c 00001400 c4004400 00400000 80000001 0c000300 00068003 84046000 00000610 |