On Target ESR1_HUMAN 0.55/CHEMBL205119
For the given ligand OI5, we have found in our database that, being scored 0.55, the most similar ligand is CHEMBL205119. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL205119 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | C=Cc1cc(O)cc2c1-c1ccc(O)c(C)c1CC2 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00002000 42000009 20000100 00010200 01020001 40000000 82000080 00000400 00000800 00080840 08100000 40008000 00000012 00200000 20000000 00082008 00020000 02001000 04000000 00220201 00100108 08100000 11404000 00400010 10800000 80000001 00022008 00000041 00404000 00220102 04000020 00800500 |