On Target MIF_HUMAN 0.3220339/CHEMBL3797437
For the given ligand OI5, we have found in our database that, being scored 0.3220339, the most similar ligand is CHEMBL3797437. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL3797437 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | Oc1cc2c(cc1C(c1ccc(C(F)(F)F)cc1)N1CCOCC1)OCO2 |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00000009 46000008 20100108 80010600 00001080 00000000 42040400 03001600 00200100 00180850 48200000 40008800 80004802 21000000 01001409 0028a108 10000000 02000000 00080000 00020a00 00040200 08008000 12000000 00468010 40000400 e0000000 003a0100 f0000001 01040380 00060002 06140000 02010600 |