On Target MK03_HUMAN 0.2875/CHEMBL4291759
For the given ligand OI5, we have found in our database that, being scored 0.2875, the most similar ligand is CHEMBL4291759. Check out the elaboration below.
| OI5 (Given Ligand) | CHEMBL4291759 (Similar Ligand) |
|---|---|
| C=C(CC)c1cccc(OC)c1C | O=C(c1ccc(-c2ccc(O)cc2)cc1)C(Cl)Cl |
|
|
|
|
|
|
| 00000000 42000008 20000108 00010200 00001000 40000000 82000080 00000400 00000800 00180840 08100000 40008000 00000002 20200000 01000001 00002008 00000000 02000000 00080000 00020201 00100100 08000000 00004000 00400010 00000000 80000001 00002000 00000000 00400300 00020102 04000000 00000500 | 00022008 00000808 20000100 40010200 00000000 00000000 02000000 00000000 00000100 00080840 08000000 40008800 00008012 00000000 00000000 00000008 10020000 02000080 04000000 10020000 00000000 08020300 10000000 00400014 00000040 88000000 00020000 00000040 00004004 00020002 80000000 00020400 |